About 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate
2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate (PubChem CID 53471226) has the molecular formula C12H8ClN5O6S
and a molecular weight of 385.75 g/mol. Its IUPAC name is 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate.
Molecular Properties
| Compound Name | 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate |
| PubChem CID | 53471226 |
| Molecular Formula | C12H8ClN5O6S |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate |
| SMILES | N#[N+]c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1Cl.O=S(=O)([O-])O |
| InChI | InChI=1S/C12H7ClN5O2.H2O4S/c13-11-7-9(3-6-12(11)15-14)17-16-8-1-4-10(5-2-8)18(19)20;1-5(2,3)4/h1-7H;(H2,1,2,3,4)/q+1;/p-1/b17-16+; |
| InChIKey | LEAZYQHEKMLEMJ-CMBBICFISA-M |
| XLogP | 4.15 |
| TPSA | 173.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate?
The IUPAC name of 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate (CID 53471226) is 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate.
What is the SMILES notation for 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate?
The canonical SMILES for 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate is N#[N+]c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1Cl.O=S(=O)([O-])O.
What is the InChIKey of 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate?
The InChIKey is LEAZYQHEKMLEMJ-CMBBICFISA-M. The full InChI is InChI=1S/C12H7ClN5O2.H2O4S/c13-11-7-9(3-6-12(11)15-14)17-16-8-1-4-10(5-2-8)18(19)20;1-5(2,3)4/h1-7H;(H2,1,2,3,4)/q+1;/p-1/b17-16+;.
What are the key properties of 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate?
2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate has a molecular weight of 385.75 g/mol, XLogP of 4.15, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(4-nitrophenyl)diazenyl]benzenediazonium;hydrogen sulfate is sourced from PubChem (CID 53471226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).