C13H6Cl2N4O2 — CID 163994512
4-[(2,6-dichloro-4-nitrophenyl)diazenyl]benzonitrile (PubChem CID 163994512) has the molecular formula C13H6Cl2N4O2 and a molecular weight of 321.12 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]benzonitrile.
| Compound Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]benzonitrile |
|---|---|
| PubChem CID | 163994512 |
| Molecular Formula | C13H6Cl2N4O2 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]benzonitrile |
| SMILES | N#Cc1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C13H6Cl2N4O2/c14-11-5-10(19(20)21)6-12(15)13(11)18-17-9-3-1-8(7-16)2-4-9/h1-6H/b18-17+ |
| InChIKey | UDNBYTHPNSCUIA-ISLYRVAYSA-N |
| XLogP | 5.19 |
| TPSA | 91.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|