C18H23Cl3N6O2 — CID 71438179
amino-[2-[2-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride (PubChem CID 71438179) has the molecular formula C18H23Cl3N6O2 and a molecular weight of 461.78 g/mol. Its IUPAC name is amino-[2-[2-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride.
| Compound Name | amino-[2-[2-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 71438179 |
| Molecular Formula | C18H23Cl3N6O2 |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | amino-[2-[2-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride |
| SMILES | C[N+](C)(N)CCNCCc1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1.[Cl-] |
| InChI | InChI=1S/C18H23Cl2N6O2.ClH/c1-26(2,21)10-9-22-8-7-13-3-5-14(6-4-13)23-24-18-16(19)11-15(25(27)28)12-17(18)20;/h3-6,11-12,22H,7-10,21H2,1-2H3;1H/q+1;/p-1/b24-23+; |
| InChIKey | ATBWRKOFKMRJRF-XMXXDQCKSA-M |
| XLogP | 1.40 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|