C14H14ClN3O2 — CID 81002179
N-[(4-chloro-3-nitrophenyl)methyl]-2-pyridin-4-ylethanamine (PubChem CID 81002179) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methyl]-2-pyridin-4-ylethanamine.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methyl]-2-pyridin-4-ylethanamine |
|---|---|
| PubChem CID | 81002179 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methyl]-2-pyridin-4-ylethanamine |
| SMILES | O=[N+]([O-])c1cc(CNCCc2ccncc2)ccc1Cl |
| InChI | InChI=1S/C14H14ClN3O2/c15-13-2-1-12(9-14(13)18(19)20)10-17-8-5-11-3-6-16-7-4-11/h1-4,6-7,9,17H,5,8,10H2 |
| InChIKey | ABWHOTOYBDUPAO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|