C12H17ClN2O3 — CID 82364708
5-[(4-chloro-3-nitrophenyl)methylamino]pentan-1-ol (PubChem CID 82364708) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 5-[(4-chloro-3-nitrophenyl)methylamino]pentan-1-ol.
| Compound Name | 5-[(4-chloro-3-nitrophenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 82364708 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5-[(4-chloro-3-nitrophenyl)methylamino]pentan-1-ol |
| SMILES | O=[N+]([O-])c1cc(CNCCCCCO)ccc1Cl |
| InChI | InChI=1S/C12H17ClN2O3/c13-11-5-4-10(8-12(11)15(17)18)9-14-6-2-1-3-7-16/h4-5,8,14,16H,1-3,6-7,9H2 |
| InChIKey | BJBWGKYYGCJAEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|