C15H22ClN3O3 — CID 110929379
1-[3-[(4-chloro-3-nitrophenyl)methylamino]propyl]piperidin-4-ol (PubChem CID 110929379) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-[3-[(4-chloro-3-nitrophenyl)methylamino]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[(4-chloro-3-nitrophenyl)methylamino]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110929379 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[3-[(4-chloro-3-nitrophenyl)methylamino]propyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1cc(CNCCCN2CCC(O)CC2)ccc1Cl |
| InChI | InChI=1S/C15H22ClN3O3/c16-14-3-2-12(10-15(14)19(21)22)11-17-6-1-7-18-8-4-13(20)5-9-18/h2-3,10,13,17,20H,1,4-9,11H2 |
| InChIKey | OGSWNEVPRVBBOE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|