C17H18ClN5O4 — CID 154299544
2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl carbamate (PubChem CID 154299544) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is 2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl carbamate.
| Compound Name | 2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl carbamate |
|---|---|
| PubChem CID | 154299544 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl carbamate |
| SMILES | NC(=O)OCCNCCc1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C17H18ClN5O4/c18-15-11-14(23(25)26)5-6-16(15)22-21-13-3-1-12(2-4-13)7-8-20-9-10-27-17(19)24/h1-6,11,20H,7-10H2,(H2,19,24)/b22-21+ |
| InChIKey | MSTXRKYWZFZRMG-QURGRASLSA-N |
| XLogP | 3.89 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|