C34H43ClN4O10 — CID 11767695
2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]acetate (PubChem CID 11767695) has the molecular formula C34H43ClN4O10 and a molecular weight of 703.19 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]acetate.
| Compound Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 11767695 |
| Molecular Formula | C34H43ClN4O10 |
| Molecular Weight | 703.19 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]acetate |
| SMILES | CCN(CCOc1ccc(CC(=O)OCCOCCOCCOCCOCCO)cc1)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C34H43ClN4O10/c1-2-38(29-7-5-28(6-8-29)36-37-33-12-9-30(39(42)43)26-32(33)35)13-15-48-31-10-3-27(4-11-31)25-34(41)49-24-23-47-22-21-46-20-19-45-18-17-44-16-14-40/h3-12,26,40H,2,13-25H2,1H3/b37-36+ |
| InChIKey | YJMRMRIKDHUPBH-BSRQYYOTSA-N |
| XLogP | 5.71 |
| TPSA | 163.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.19 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|