C18H21ClN4O4 — CID 71320186
4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-methoxyethyl)aniline (PubChem CID 71320186) has the molecular formula C18H21ClN4O4 and a molecular weight of 392.84 g/mol. Its IUPAC name is 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 71320186 |
| Molecular Formula | C18H21ClN4O4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-methoxyethyl)aniline |
| SMILES | COCCN(CCOC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C18H21ClN4O4/c1-26-11-9-22(10-12-27-2)15-5-3-14(4-6-15)20-21-18-8-7-16(23(24)25)13-17(18)19/h3-8,13H,9-12H2,1-2H3/b21-20+ |
| InChIKey | BAPHREAOYLLKEJ-QZQOTICOSA-N |
| XLogP | 4.76 |
| TPSA | 89.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|