C23H28ClN5O7 — CID 89467896
2-[N-(2-acetyloxyethyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]-3-(ethoxymethylamino)anilino]ethyl acetate (PubChem CID 89467896) has the molecular formula C23H28ClN5O7 and a molecular weight of 521.96 g/mol. Its IUPAC name is 2-[N-(2-acetyloxyethyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]-3-(ethoxymethylamino)anilino]ethyl acetate.
| Compound Name | 2-[N-(2-acetyloxyethyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]-3-(ethoxymethylamino)anilino]ethyl acetate |
|---|---|
| PubChem CID | 89467896 |
| Molecular Formula | C23H28ClN5O7 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[N-(2-acetyloxyethyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]-3-(ethoxymethylamino)anilino]ethyl acetate |
| SMILES | CCOCNc1cc(N(CCOC(C)=O)CCOC(C)=O)ccc1/N=N/c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H28ClN5O7/c1-4-34-15-25-23-14-18(28(9-11-35-16(2)30)10-12-36-17(3)31)5-8-22(23)27-26-21-7-6-19(29(32)33)13-20(21)24/h5-8,13-14,25H,4,9-12,15H2,1-3H3/b27-26+ |
| InChIKey | DKJCDLPLELDPMV-CYYJNZCTSA-N |
| XLogP | 5.00 |
| TPSA | 144.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|