C19H20ClN5O4 — CID 88987054
2-[[4-[(2-chloro-4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]-(2-cyanoethyl)amino]ethyl acetate (PubChem CID 88987054) has the molecular formula C19H20ClN5O4 and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-[[4-[(2-chloro-4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]-(2-cyanoethyl)amino]ethyl acetate.
| Compound Name | 2-[[4-[(2-chloro-4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]-(2-cyanoethyl)amino]ethyl acetate |
|---|---|
| PubChem CID | 88987054 |
| Molecular Formula | C19H20ClN5O4 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[[4-[(2-chloro-4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]-(2-cyanoethyl)amino]ethyl acetate |
| SMILES | CC(=O)OCCN(CCC#N)C1=CCC(/N=N/c2ccc([N+](=O)[O-])cc2Cl)C=C1 |
| InChI | InChI=1S/C19H20ClN5O4/c1-14(26)29-12-11-24(10-2-9-21)16-5-3-15(4-6-16)22-23-19-8-7-17(25(27)28)13-18(19)20/h3,5-8,13,15H,2,4,10-12H2,1H3/b23-22+ |
| InChIKey | SQCJDFSBCIUADY-GHVJWSGMSA-N |
| XLogP | 4.32 |
| TPSA | 121.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|