C22H24N6O6 — CID 3089599
2-[N-(2-cyanoethyl)-4-[(2,4,6-trimethyl-3,5-dinitrophenyl)diazenyl]anilino]ethyl acetate (PubChem CID 3089599) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-[N-(2-cyanoethyl)-4-[(2,4,6-trimethyl-3,5-dinitrophenyl)diazenyl]anilino]ethyl acetate.
| Compound Name | 2-[N-(2-cyanoethyl)-4-[(2,4,6-trimethyl-3,5-dinitrophenyl)diazenyl]anilino]ethyl acetate |
|---|---|
| PubChem CID | 3089599 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[N-(2-cyanoethyl)-4-[(2,4,6-trimethyl-3,5-dinitrophenyl)diazenyl]anilino]ethyl acetate |
| SMILES | CC(=O)OCCN(CCC#N)c1ccc(/N=N/c2c(C)c([N+](=O)[O-])c(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C22H24N6O6/c1-14-20(15(2)22(28(32)33)16(3)21(14)27(30)31)25-24-18-6-8-19(9-7-18)26(11-5-10-23)12-13-34-17(4)29/h6-9H,5,11-13H2,1-4H3/b25-24+ |
| InChIKey | MUXYHKPDDYJIMZ-OCOZRVBESA-N |
| XLogP | 5.13 |
| TPSA | 164.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|