C20H24N6O4 — CID 101391928
N-[2-[N-(2-acetamidoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]acetamide (PubChem CID 101391928) has the molecular formula C20H24N6O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[2-[N-(2-acetamidoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]acetamide.
| Compound Name | N-[2-[N-(2-acetamidoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]acetamide |
|---|---|
| PubChem CID | 101391928 |
| Molecular Formula | C20H24N6O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[2-[N-(2-acetamidoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]acetamide |
| SMILES | CC(=O)NCCN(CCNC(C)=O)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H24N6O4/c1-15(27)21-11-13-25(14-12-22-16(2)28)19-7-3-17(4-8-19)23-24-18-5-9-20(10-6-18)26(29)30/h3-10H,11-14H2,1-2H3,(H,21,27)(H,22,28)/b24-23+ |
| InChIKey | AQUZVTGCAKMRNC-WCWDXBQESA-N |
| XLogP | 3.09 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|