C20H26N4O2 — CID 2818364
N,N-dibutyl-4-[(4-nitrophenyl)diazenyl]aniline (PubChem CID 2818364) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N,N-dibutyl-4-[(4-nitrophenyl)diazenyl]aniline.
| Compound Name | N,N-dibutyl-4-[(4-nitrophenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 2818364 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N,N-dibutyl-4-[(4-nitrophenyl)diazenyl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-3-5-15-23(16-6-4-2)19-11-7-17(8-12-19)21-22-18-9-13-20(14-10-18)24(25)26/h7-14H,3-6,15-16H2,1-2H3/b22-21+ |
| InChIKey | KNBRTHIMUIKCSH-QURGRASLSA-N |
| XLogP | 6.42 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|