C18H22N4O3 — CID 165108289
2-[3-methyl-4-[(4-nitrophenyl)diazenyl]-N-propylanilino]ethanol (PubChem CID 165108289) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[3-methyl-4-[(4-nitrophenyl)diazenyl]-N-propylanilino]ethanol.
| Compound Name | 2-[3-methyl-4-[(4-nitrophenyl)diazenyl]-N-propylanilino]ethanol |
|---|---|
| PubChem CID | 165108289 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[3-methyl-4-[(4-nitrophenyl)diazenyl]-N-propylanilino]ethanol |
| SMILES | CCCN(CCO)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C18H22N4O3/c1-3-10-21(11-12-23)17-8-9-18(14(2)13-17)20-19-15-4-6-16(7-5-15)22(24)25/h4-9,13,23H,3,10-12H2,1-2H3/b20-19+ |
| InChIKey | LRRBOYWTMWFNRE-FMQUCBEESA-N |
| XLogP | 4.53 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|