C16H16Br2N4O3 — CID 141406177
2-[4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]ethanol (PubChem CID 141406177) has the molecular formula C16H16Br2N4O3 and a molecular weight of 472.14 g/mol. Its IUPAC name is 2-[4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]ethanol.
| Compound Name | 2-[4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]ethanol |
|---|---|
| PubChem CID | 141406177 |
| Molecular Formula | C16H16Br2N4O3 |
| Molecular Weight | 472.14 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | 2-[4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/N=N/c2c(Br)cc([N+](=O)[O-])cc2Br)cc1 |
| InChI | InChI=1S/C16H16Br2N4O3/c1-2-21(7-8-23)12-5-3-11(4-6-12)19-20-16-14(17)9-13(22(24)25)10-15(16)18/h3-6,9-10,23H,2,7-8H2,1H3/b20-19+ |
| InChIKey | VEHOPRBMXSZCNN-FMQUCBEESA-N |
| XLogP | 5.35 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.14 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|