C25H22Br2N4O5 — CID 155699002
2-oxopropyl 3-[N-benzyl-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]anilino]propanoate (PubChem CID 155699002) has the molecular formula C25H22Br2N4O5 and a molecular weight of 618.28 g/mol. Its IUPAC name is 2-oxopropyl 3-[N-benzyl-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]anilino]propanoate.
| Compound Name | 2-oxopropyl 3-[N-benzyl-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]anilino]propanoate |
|---|---|
| PubChem CID | 155699002 |
| Molecular Formula | C25H22Br2N4O5 |
| Molecular Weight | 618.28 g/mol |
| Exact Mass | 616.00 |
| IUPAC Name | 2-oxopropyl 3-[N-benzyl-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]anilino]propanoate |
| SMILES | CC(=O)COC(=O)CCN(Cc1ccccc1)c1ccc(/N=N/c2c(Br)cc([N+](=O)[O-])cc2Br)cc1 |
| InChI | InChI=1S/C25H22Br2N4O5/c1-17(32)16-36-24(33)11-12-30(15-18-5-3-2-4-6-18)20-9-7-19(8-10-20)28-29-25-22(26)13-21(31(34)35)14-23(25)27/h2-10,13-14H,11-12,15-16H2,1H3/b29-28+ |
| InChIKey | OPDWZFPYDBCXJU-ZQHSETAFSA-N |
| XLogP | 7.06 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.28 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|