C25H26ClN5O5 — CID 155699054
methyl 3-[3-acetamido-N-benzyl-4-[2-(2-chloro-4-nitrophenyl)hydrazinyl]anilino]propanoate (PubChem CID 155699054) has the molecular formula C25H26ClN5O5 and a molecular weight of 511.97 g/mol. Its IUPAC name is methyl 3-[3-acetamido-N-benzyl-4-[2-(2-chloro-4-nitrophenyl)hydrazinyl]anilino]propanoate.
| Compound Name | methyl 3-[3-acetamido-N-benzyl-4-[2-(2-chloro-4-nitrophenyl)hydrazinyl]anilino]propanoate |
|---|---|
| PubChem CID | 155699054 |
| Molecular Formula | C25H26ClN5O5 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | methyl 3-[3-acetamido-N-benzyl-4-[2-(2-chloro-4-nitrophenyl)hydrazinyl]anilino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)c1ccc(NNc2ccc([N+](=O)[O-])cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C25H26ClN5O5/c1-17(32)27-24-15-19(30(13-12-25(33)36-2)16-18-6-4-3-5-7-18)8-11-23(24)29-28-22-10-9-20(31(34)35)14-21(22)26/h3-11,14-15,28-29H,12-13,16H2,1-2H3,(H,27,32) |
| InChIKey | QZKMZYXXNZUHBV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|