C19H15ClN2O7 — CID 98705971
methyl (3R)-3-benzoyl-5-(2-chloro-4-nitroanilino)-4,5-dioxopentanoate (PubChem CID 98705971) has the molecular formula C19H15ClN2O7 and a molecular weight of 418.79 g/mol. Its IUPAC name is methyl (3R)-3-benzoyl-5-(2-chloro-4-nitroanilino)-4,5-dioxopentanoate.
| Compound Name | methyl (3R)-3-benzoyl-5-(2-chloro-4-nitroanilino)-4,5-dioxopentanoate |
|---|---|
| PubChem CID | 98705971 |
| Molecular Formula | C19H15ClN2O7 |
| Molecular Weight | 418.79 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | methyl (3R)-3-benzoyl-5-(2-chloro-4-nitroanilino)-4,5-dioxopentanoate |
| SMILES | COC(=O)C[C@@H](C(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O7/c1-29-16(23)10-13(17(24)11-5-3-2-4-6-11)18(25)19(26)21-15-8-7-12(22(27)28)9-14(15)20/h2-9,13H,10H2,1H3,(H,21,26)/t13-/m1/s1 |
| InChIKey | OZTJSURCAFGKAP-CYBMUJFWSA-N |
| XLogP | 2.82 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|