C28H27ClN6O9 — CID 90138051
2-oxopropyl 3-[5-acetamido-N-benzyl-4-[(2-chloro-4,6-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate (PubChem CID 90138051) has the molecular formula C28H27ClN6O9 and a molecular weight of 627.01 g/mol. Its IUPAC name is 2-oxopropyl 3-[5-acetamido-N-benzyl-4-[(2-chloro-4,6-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate.
| Compound Name | 2-oxopropyl 3-[5-acetamido-N-benzyl-4-[(2-chloro-4,6-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate |
|---|---|
| PubChem CID | 90138051 |
| Molecular Formula | C28H27ClN6O9 |
| Molecular Weight | 627.01 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 2-oxopropyl 3-[5-acetamido-N-benzyl-4-[(2-chloro-4,6-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate |
| SMILES | COc1cc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2[N+](=O)[O-])c(NC(C)=O)cc1N(CCC(=O)OCC(C)=O)Cc1ccccc1 |
| InChI | InChI=1S/C28H27ClN6O9/c1-17(36)16-44-27(38)9-10-33(15-19-7-5-4-6-8-19)24-13-22(30-18(2)37)23(14-26(24)43-3)31-32-28-21(29)11-20(34(39)40)12-25(28)35(41)42/h4-8,11-14H,9-10,15-16H2,1-3H3,(H,30,37)/b32-31+ |
| InChIKey | QTBRKAYGOJUDSS-QNEJGDQOSA-N |
| XLogP | 6.07 |
| TPSA | 195.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|