C21H23BrN6O9 — CID 21118076
methyl 3-[5-acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-(2-hydroxyethyl)-2-methoxyanilino]propanoate (PubChem CID 21118076) has the molecular formula C21H23BrN6O9 and a molecular weight of 583.35 g/mol. Its IUPAC name is methyl 3-[5-acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-(2-hydroxyethyl)-2-methoxyanilino]propanoate.
| Compound Name | methyl 3-[5-acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-(2-hydroxyethyl)-2-methoxyanilino]propanoate |
|---|---|
| PubChem CID | 21118076 |
| Molecular Formula | C21H23BrN6O9 |
| Molecular Weight | 583.35 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | methyl 3-[5-acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-(2-hydroxyethyl)-2-methoxyanilino]propanoate |
| SMILES | COC(=O)CCN(CCO)c1cc(NC(C)=O)c(/N=N/c2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H23BrN6O9/c1-12(30)23-15-10-17(26(6-7-29)5-4-20(31)37-3)19(36-2)11-16(15)24-25-21-14(22)8-13(27(32)33)9-18(21)28(34)35/h8-11,29H,4-7H2,1-3H3,(H,23,30)/b25-24+ |
| InChIKey | ZOWVFNSUMOEMSW-OCOZRVBESA-N |
| XLogP | 4.01 |
| TPSA | 199.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|