About 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol
2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol (PubChem CID 88787908) has the molecular formula C20H24BrN5O6
and a molecular weight of 510.35 g/mol. Its IUPAC name is 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol |
| PubChem CID | 88787908 |
| Molecular Formula | C20H24BrN5O6 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol |
| SMILES | CCCCN(CCO)c1cc(C)c(/N=N/c2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C20H24BrN5O6/c1-4-5-6-24(7-8-27)14-9-13(2)19(18(12-14)32-3)22-23-20-16(21)10-15(25(28)29)11-17(20)26(30)31/h9-12,27H,4-8H2,1-3H3/b23-22+ |
| InChIKey | MCRXLHBMKOQKIZ-GHVJWSGMSA-N |
| XLogP | 5.60 |
| TPSA | 143.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol?
The IUPAC name of 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol (CID 88787908) is 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol.
What is the SMILES notation for 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol?
The canonical SMILES for 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol is CCCCN(CCO)c1cc(C)c(/N=N/c2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])c(OC)c1.
What is the InChIKey of 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol?
The InChIKey is MCRXLHBMKOQKIZ-GHVJWSGMSA-N. The full InChI is InChI=1S/C20H24BrN5O6/c1-4-5-6-24(7-8-27)14-9-13(2)19(18(12-14)32-3)22-23-20-16(21)10-15(25(28)29)11-17(20)26(30)31/h9-12,27H,4-8H2,1-3H3/b23-22+.
What are the key properties of 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol?
2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol has a molecular weight of 510.35 g/mol, XLogP of 5.60, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-N-butyl-3-methoxy-5-methylanilino]ethanol is sourced from PubChem (CID 88787908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).