C22H23BrN6O10 — CID 129215607
methyl 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)-5-(propanoylamino)anilino]acetate (PubChem CID 129215607) has the molecular formula C22H23BrN6O10 and a molecular weight of 611.36 g/mol. Its IUPAC name is methyl 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)-5-(propanoylamino)anilino]acetate.
| Compound Name | methyl 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)-5-(propanoylamino)anilino]acetate |
|---|---|
| PubChem CID | 129215607 |
| Molecular Formula | C22H23BrN6O10 |
| Molecular Weight | 611.36 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | methyl 2-[4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)-5-(propanoylamino)anilino]acetate |
| SMILES | CCC(=O)Nc1cc(N(CC(=O)OC)CC(=O)OC)c(OC)cc1/N=N/c1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23BrN6O10/c1-5-19(30)24-14-8-16(27(10-20(31)38-3)11-21(32)39-4)18(37-2)9-15(14)25-26-22-13(23)6-12(28(33)34)7-17(22)29(35)36/h6-9H,5,10-11H2,1-4H3,(H,24,30)/b26-25+ |
| InChIKey | BXRBKYJQUMZMAV-OCEACIFDSA-N |
| XLogP | 4.19 |
| TPSA | 205.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|