C23H29BrN6O10 — CID 102503883
N-[5-[bis(2-hydroxy-3-methoxypropyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide (PubChem CID 102503883) has the molecular formula C23H29BrN6O10 and a molecular weight of 629.42 g/mol. Its IUPAC name is N-[5-[bis(2-hydroxy-3-methoxypropyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[5-[bis(2-hydroxy-3-methoxypropyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 102503883 |
| Molecular Formula | C23H29BrN6O10 |
| Molecular Weight | 629.42 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | N-[5-[bis(2-hydroxy-3-methoxypropyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide |
| SMILES | COCC(O)CN(CC(O)COC)c1cc(NC(C)=O)c(/N=N/c2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H29BrN6O10/c1-13(31)25-18-7-20(28(9-15(32)11-38-2)10-16(33)12-39-3)22(40-4)8-19(18)26-27-23-17(24)5-14(29(34)35)6-21(23)30(36)37/h5-8,15-16,32-33H,9-12H2,1-4H3,(H,25,31)/b27-26+ |
| InChIKey | PTXPRNPXVGJYBO-CYYJNZCTSA-N |
| XLogP | 3.47 |
| TPSA | 211.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|