C21H25FN6O8 — CID 155699021
N-[5-[bis(2-methoxyethyl)amino]-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide (PubChem CID 155699021) has the molecular formula C21H25FN6O8 and a molecular weight of 508.46 g/mol. Its IUPAC name is N-[5-[bis(2-methoxyethyl)amino]-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[5-[bis(2-methoxyethyl)amino]-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 155699021 |
| Molecular Formula | C21H25FN6O8 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[5-[bis(2-methoxyethyl)amino]-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide |
| SMILES | COCCN(CCOC)c1cc(NC(C)=O)c(/N=N/c2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H25FN6O8/c1-13(29)23-15-10-20(26(5-7-34-2)6-8-35-3)21(36-4)11-16(15)24-25-17-9-14(22)18(27(30)31)12-19(17)28(32)33/h9-12H,5-8H2,1-4H3,(H,23,29)/b25-24+ |
| InChIKey | CRIMNHPWRSAVLD-OCOZRVBESA-N |
| XLogP | 4.12 |
| TPSA | 171.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|