C21H26N6O6 — CID 10994155
N-[5-(diethylamino)-2-[(2,4-dinitro-5-propoxyphenyl)diazenyl]phenyl]acetamide (PubChem CID 10994155) has the molecular formula C21H26N6O6 and a molecular weight of 458.48 g/mol. Its IUPAC name is N-[5-(diethylamino)-2-[(2,4-dinitro-5-propoxyphenyl)diazenyl]phenyl]acetamide.
| Compound Name | N-[5-(diethylamino)-2-[(2,4-dinitro-5-propoxyphenyl)diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10994155 |
| Molecular Formula | C21H26N6O6 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-[5-(diethylamino)-2-[(2,4-dinitro-5-propoxyphenyl)diazenyl]phenyl]acetamide |
| SMILES | CCCOc1cc(/N=N/c2ccc(N(CC)CC)cc2NC(C)=O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N6O6/c1-5-10-33-21-12-18(19(26(29)30)13-20(21)27(31)32)24-23-16-9-8-15(25(6-2)7-3)11-17(16)22-14(4)28/h8-9,11-13H,5-7,10H2,1-4H3,(H,22,28)/b24-23+ |
| InChIKey | NXDRPEYFVHJUKA-WCWDXBQESA-N |
| XLogP | 5.51 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|