C19H19Br2N5O5 — CID 90954472
3-[3-acetamido-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]propanoic acid (PubChem CID 90954472) has the molecular formula C19H19Br2N5O5 and a molecular weight of 557.20 g/mol. Its IUPAC name is 3-[3-acetamido-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]propanoic acid.
| Compound Name | 3-[3-acetamido-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]propanoic acid |
|---|---|
| PubChem CID | 90954472 |
| Molecular Formula | C19H19Br2N5O5 |
| Molecular Weight | 557.20 g/mol |
| Exact Mass | 554.98 |
| IUPAC Name | 3-[3-acetamido-4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylanilino]propanoic acid |
| SMILES | CCN(CCC(=O)O)c1ccc(/N=N/c2c(Br)cc([N+](=O)[O-])cc2Br)c(NC(C)=O)c1 |
| InChI | InChI=1S/C19H19Br2N5O5/c1-3-25(7-6-18(28)29)12-4-5-16(17(10-12)22-11(2)27)23-24-19-14(20)8-13(26(30)31)9-15(19)21/h4-5,8-10H,3,6-7H2,1-2H3,(H,22,27)(H,28,29)/b24-23+ |
| InChIKey | ANXQTLHQLBAIED-WCWDXBQESA-N |
| XLogP | 5.79 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.20 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|