About methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate
methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate (PubChem CID 129215642) has the molecular formula C21H19N7O5
and a molecular weight of 449.43 g/mol. Its IUPAC name is methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate |
| PubChem CID | 129215642 |
| Molecular Formula | C21H19N7O5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate |
| SMILES | CCN(CC(=O)OC)c1ccc(/N=N/c2c(C#N)cc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C21H19N7O5/c1-4-27(12-20(30)33-3)16-5-6-18(19(9-16)24-13(2)29)25-26-21-14(10-22)7-17(28(31)32)8-15(21)11-23/h5-9H,4,12H2,1-3H3,(H,24,29)/b26-25+ |
| InChIKey | GJAZNQQFDYZEOZ-OCEACIFDSA-N |
| XLogP | 3.71 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate?
The IUPAC name of methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate (CID 129215642) is methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate.
What is the SMILES notation for methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate?
The canonical SMILES for methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate is CCN(CC(=O)OC)c1ccc(/N=N/c2c(C#N)cc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1.
What is the InChIKey of methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate?
The InChIKey is GJAZNQQFDYZEOZ-OCEACIFDSA-N. The full InChI is InChI=1S/C21H19N7O5/c1-4-27(12-20(30)33-3)16-5-6-18(19(9-16)24-13(2)29)25-26-21-14(10-22)7-17(28(31)32)8-15(21)11-23/h5-9H,4,12H2,1-3H3,(H,24,29)/b26-25+.
What are the key properties of methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate?
methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate has a molecular weight of 449.43 g/mol, XLogP of 3.71, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate is sourced from PubChem (CID 129215642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).