C21H19N7O5 — CID 129215642
methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate (PubChem CID 129215642) has the molecular formula C21H19N7O5 and a molecular weight of 449.43 g/mol. Its IUPAC name is methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate.
| Compound Name | methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate |
|---|---|
| PubChem CID | 129215642 |
| Molecular Formula | C21H19N7O5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | methyl 2-[3-acetamido-4-[(2,6-dicyano-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate |
| SMILES | CCN(CC(=O)OC)c1ccc(/N=N/c2c(C#N)cc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C21H19N7O5/c1-4-27(12-20(30)33-3)16-5-6-18(19(9-16)24-13(2)29)25-26-21-14(10-22)7-17(28(31)32)8-15(21)11-23/h5-9H,4,12H2,1-3H3,(H,24,29)/b26-25+ |
| InChIKey | GJAZNQQFDYZEOZ-OCEACIFDSA-N |
| XLogP | 3.71 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|