C29H24N8O5 — CID 59434930
N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]phenyl]acetamide (PubChem CID 59434930) has the molecular formula C29H24N8O5 and a molecular weight of 564.56 g/mol. Its IUPAC name is N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]phenyl]acetamide.
| Compound Name | N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 59434930 |
| Molecular Formula | C29H24N8O5 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]phenyl]acetamide |
| SMILES | CCN(CCCN1C(=O)c2ccccc2C1=O)c1ccc(/N=N/c2c(C#N)cc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C29H24N8O5/c1-3-35(11-6-12-36-28(39)23-7-4-5-8-24(23)29(36)40)21-9-10-25(26(15-21)32-18(2)38)33-34-27-19(16-30)13-22(37(41)42)14-20(27)17-31/h4-5,7-10,13-15H,3,6,11-12H2,1-2H3,(H,32,38)/b34-33+ |
| InChIKey | WVKUFEKQHZVKBJ-JEIPZWNWSA-N |
| XLogP | 5.22 |
| TPSA | 185.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|