C19H19BrN6O4 — CID 21413081
methyl N-[2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]carbamate (PubChem CID 21413081) has the molecular formula C19H19BrN6O4 and a molecular weight of 475.30 g/mol. Its IUPAC name is methyl N-[2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]carbamate.
| Compound Name | methyl N-[2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 21413081 |
| Molecular Formula | C19H19BrN6O4 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | methyl N-[2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]carbamate |
| SMILES | CCN(CC)c1ccc(/N=N/c2c(Br)cc([N+](=O)[O-])cc2C#N)c(NC(=O)OC)c1 |
| InChI | InChI=1S/C19H19BrN6O4/c1-4-25(5-2)13-6-7-16(17(10-13)22-19(27)30-3)23-24-18-12(11-21)8-14(26(28)29)9-15(18)20/h6-10H,4-5H2,1-3H3,(H,22,27)/b24-23+ |
| InChIKey | HGAHUVHVDUSVFB-WCWDXBQESA-N |
| XLogP | 5.67 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|