C22H27N7O3 — CID 3086017
N-[5-(diethylamino)-2-[(2,6-dimethanimidoyl-4-nitrophenyl)diazenyl]phenyl]-2-methylpropanamide (PubChem CID 3086017) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[5-(diethylamino)-2-[(2,6-dimethanimidoyl-4-nitrophenyl)diazenyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[5-(diethylamino)-2-[(2,6-dimethanimidoyl-4-nitrophenyl)diazenyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 3086017 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[5-(diethylamino)-2-[(2,6-dimethanimidoyl-4-nitrophenyl)diazenyl]phenyl]-2-methylpropanamide |
| SMILES | [H]/N=C/c1cc([N+](=O)[O-])cc(/C=N/[H])c1/N=N/c1ccc(N(CC)CC)cc1NC(=O)C(C)C |
| InChI | InChI=1S/C22H27N7O3/c1-5-28(6-2)17-7-8-19(20(11-17)25-22(30)14(3)4)26-27-21-15(12-23)9-18(29(31)32)10-16(21)13-24/h7-14,23-24H,5-6H2,1-4H3,(H,25,30)/b23-12+,24-13+,27-26+ |
| InChIKey | JIXGLSZQLPKKMH-ZVHSICSOSA-N |
| XLogP | 5.45 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|