C22H25N5O7 — CID 71558290
dimethyl 4-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3-nitrobenzene-1,2-dicarboxylate (PubChem CID 71558290) has the molecular formula C22H25N5O7 and a molecular weight of 471.47 g/mol. Its IUPAC name is dimethyl 4-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3-nitrobenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3-nitrobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71558290 |
| Molecular Formula | C22H25N5O7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | dimethyl 4-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3-nitrobenzene-1,2-dicarboxylate |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(C(=O)OC)c(C(=O)OC)c2[N+](=O)[O-])c(NC(C)=O)c1 |
| InChI | InChI=1S/C22H25N5O7/c1-6-26(7-2)14-8-10-16(18(12-14)23-13(3)28)24-25-17-11-9-15(21(29)33-4)19(22(30)34-5)20(17)27(31)32/h8-12H,6-7H2,1-5H3,(H,23,28)/b25-24+ |
| InChIKey | IWJHYOJRVUPRNO-OCOZRVBESA-N |
| XLogP | 4.39 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|