C28H40N6O8P+ — CID 88801295
[2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3,5-dinitro-4,6-dipentylphenoxy]-hydroxy-oxophosphanium (PubChem CID 88801295) has the molecular formula C28H40N6O8P+ and a molecular weight of 619.64 g/mol. Its IUPAC name is [2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3,5-dinitro-4,6-dipentylphenoxy]-hydroxy-oxophosphanium.
| Compound Name | [2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3,5-dinitro-4,6-dipentylphenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88801295 |
| Molecular Formula | C28H40N6O8P+ |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | [2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-3,5-dinitro-4,6-dipentylphenoxy]-hydroxy-oxophosphanium |
| SMILES | CCCCCc1c(O[P+](=O)O)c(/N=N/c2ccc(N(CC)CC)cc2NC(C)=O)c([N+](=O)[O-])c(CCCCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C28H39N6O8P/c1-6-10-12-14-21-26(33(36)37)22(15-13-11-7-2)28(42-43(40)41)25(27(21)34(38)39)31-30-23-17-16-20(32(8-3)9-4)18-24(23)29-19(5)35/h16-18H,6-15H2,1-5H3,(H-,29,31,35,40,41)/p+1 |
| InChIKey | OBUIAEQOIUWGCR-UHFFFAOYSA-O |
| XLogP | 8.22 |
| TPSA | 189.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|