C19H21FN6O5 — CID 155150461
N-[5-(diethylamino)-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]phenyl]propanamide (PubChem CID 155150461) has the molecular formula C19H21FN6O5 and a molecular weight of 432.41 g/mol. Its IUPAC name is N-[5-(diethylamino)-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]phenyl]propanamide.
| Compound Name | N-[5-(diethylamino)-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 155150461 |
| Molecular Formula | C19H21FN6O5 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[5-(diethylamino)-2-[(5-fluoro-2,4-dinitrophenyl)diazenyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(N(CC)CC)ccc1/N=N/c1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21FN6O5/c1-4-19(27)21-15-9-12(24(5-2)6-3)7-8-14(15)22-23-16-10-13(20)17(25(28)29)11-18(16)26(30)31/h7-11H,4-6H2,1-3H3,(H,21,27)/b23-22+ |
| InChIKey | DORIMSHHVAUBGI-GHVJWSGMSA-N |
| XLogP | 5.25 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|