C18H19N7O6S2 — CID 155699076
[5-[[4-(diethylamino)-2-(methanesulfonamido)phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate (PubChem CID 155699076) has the molecular formula C18H19N7O6S2 and a molecular weight of 493.53 g/mol. Its IUPAC name is [5-[[4-(diethylamino)-2-(methanesulfonamido)phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate.
| Compound Name | [5-[[4-(diethylamino)-2-(methanesulfonamido)phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate |
|---|---|
| PubChem CID | 155699076 |
| Molecular Formula | C18H19N7O6S2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | [5-[[4-(diethylamino)-2-(methanesulfonamido)phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate |
| SMILES | CCN(CC)c1ccc(/N=N/c2cc(SC#N)c([N+](=O)[O-])cc2[N+](=O)[O-])c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H19N7O6S2/c1-4-23(5-2)12-6-7-13(14(8-12)22-33(3,30)31)20-21-15-9-18(32-11-19)17(25(28)29)10-16(15)24(26)27/h6-10,22H,4-5H2,1-3H3/b21-20+ |
| InChIKey | JETYZCPBTMXNSE-QZQOTICOSA-N |
| XLogP | 4.71 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|