C18H16N6O2 — CID 71327840
4-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-3-nitrobenzonitrile (PubChem CID 71327840) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-3-nitrobenzonitrile.
| Compound Name | 4-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 71327840 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-3-nitrobenzonitrile |
| SMILES | CCN(CCC#N)c1ccc(/N=N/c2ccc(C#N)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N6O2/c1-2-23(11-3-10-19)16-7-5-15(6-8-16)21-22-17-9-4-14(13-20)12-18(17)24(25)26/h4-9,12H,2-3,11H2,1H3/b22-21+ |
| InChIKey | JTJBUYCMSWECGQ-QURGRASLSA-N |
| XLogP | 4.62 |
| TPSA | 118.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|