C17H17Br2N5 — CID 171394343
3-[4-[(4-amino-2,6-dibromophenyl)diazenyl]-N-ethylanilino]propanenitrile (PubChem CID 171394343) has the molecular formula C17H17Br2N5 and a molecular weight of 451.17 g/mol. Its IUPAC name is 3-[4-[(4-amino-2,6-dibromophenyl)diazenyl]-N-ethylanilino]propanenitrile.
| Compound Name | 3-[4-[(4-amino-2,6-dibromophenyl)diazenyl]-N-ethylanilino]propanenitrile |
|---|---|
| PubChem CID | 171394343 |
| Molecular Formula | C17H17Br2N5 |
| Molecular Weight | 451.17 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 3-[4-[(4-amino-2,6-dibromophenyl)diazenyl]-N-ethylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/N=N/c2c(Br)cc(N)cc2Br)cc1 |
| InChI | InChI=1S/C17H17Br2N5/c1-2-24(9-3-8-20)14-6-4-13(5-7-14)22-23-17-15(18)10-12(21)11-16(17)19/h4-7,10-11H,2-3,9,21H2,1H3/b23-22+ |
| InChIKey | QQLWMZVOJHCNLR-GHVJWSGMSA-N |
| XLogP | 5.95 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.17 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|