C16H16Cl3N3 — CID 86120497
N,N-diethyl-4-[(2,4,6-trichlorophenyl)diazenyl]aniline (PubChem CID 86120497) has the molecular formula C16H16Cl3N3 and a molecular weight of 356.68 g/mol. Its IUPAC name is N,N-diethyl-4-[(2,4,6-trichlorophenyl)diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[(2,4,6-trichlorophenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 86120497 |
| Molecular Formula | C16H16Cl3N3 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N,N-diethyl-4-[(2,4,6-trichlorophenyl)diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl3N3/c1-3-22(4-2)13-7-5-12(6-8-13)20-21-16-14(18)9-11(17)10-15(16)19/h5-10H,3-4H2,1-2H3/b21-20+ |
| InChIKey | SVRTYNABOMOIQT-QZQOTICOSA-N |
| XLogP | 6.91 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|