C21H19Cl2N3 — CID 123495257
N-benzyl-4-[(2,6-dichloro-4-methylphenyl)diazenyl]-N-methylaniline (PubChem CID 123495257) has the molecular formula C21H19Cl2N3 and a molecular weight of 384.31 g/mol. Its IUPAC name is N-benzyl-4-[(2,6-dichloro-4-methylphenyl)diazenyl]-N-methylaniline.
| Compound Name | N-benzyl-4-[(2,6-dichloro-4-methylphenyl)diazenyl]-N-methylaniline |
|---|---|
| PubChem CID | 123495257 |
| Molecular Formula | C21H19Cl2N3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-benzyl-4-[(2,6-dichloro-4-methylphenyl)diazenyl]-N-methylaniline |
| SMILES | Cc1cc(Cl)c(/N=N/c2ccc(N(C)Cc3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3/c1-15-12-19(22)21(20(23)13-15)25-24-17-8-10-18(11-9-17)26(2)14-16-6-4-3-5-7-16/h3-13H,14H2,1-2H3/b25-24+ |
| InChIKey | UESITHLPQRCGTN-OCOZRVBESA-N |
| XLogP | 7.35 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|