C18H21N6+ — CID 135966530
N-benzyl-4-[(2,3-dimethyl-1H-1,2,4-triazol-2-ium-5-yl)diazenyl]-N-methylaniline (PubChem CID 135966530) has the molecular formula C18H21N6+ and a molecular weight of 321.41 g/mol. Its IUPAC name is N-benzyl-4-[(2,3-dimethyl-1H-1,2,4-triazol-2-ium-5-yl)diazenyl]-N-methylaniline.
| Compound Name | N-benzyl-4-[(2,3-dimethyl-1H-1,2,4-triazol-2-ium-5-yl)diazenyl]-N-methylaniline |
|---|---|
| PubChem CID | 135966530 |
| Molecular Formula | C18H21N6+ |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-benzyl-4-[(2,3-dimethyl-1H-1,2,4-triazol-2-ium-5-yl)diazenyl]-N-methylaniline |
| SMILES | Cc1nc(/N=N/c2ccc(N(C)Cc3ccccc3)cc2)[nH][n+]1C |
| InChI | InChI=1S/C18H20N6/c1-14-19-18(22-24(14)3)21-20-16-9-11-17(12-10-16)23(2)13-15-7-5-4-6-8-15/h4-12H,13H2,1-3H3/p+1/b21-20+ |
| InChIKey | CJYJXZJXJRLUNY-QZQOTICOSA-O |
| XLogP | 3.59 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|