C25H29N5 — CID 87500130
N-benzyl-N-methyl-4-[[4-(pentyldiazenyl)phenyl]diazenyl]aniline (PubChem CID 87500130) has the molecular formula C25H29N5 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-[[4-(pentyldiazenyl)phenyl]diazenyl]aniline.
| Compound Name | N-benzyl-N-methyl-4-[[4-(pentyldiazenyl)phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 87500130 |
| Molecular Formula | C25H29N5 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-benzyl-N-methyl-4-[[4-(pentyldiazenyl)phenyl]diazenyl]aniline |
| SMILES | CCCCC/N=N/c1ccc(/N=N/c2ccc(N(C)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H29N5/c1-3-4-8-19-26-27-22-11-13-23(14-12-22)28-29-24-15-17-25(18-16-24)30(2)20-21-9-6-5-7-10-21/h5-7,9-18H,3-4,8,19-20H2,1-2H3/b27-26+,29-28+ |
| InChIKey | MOUPGEJPTPWOHB-ZDXBJJIESA-N |
| XLogP | 8.01 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|