C18H18Br2N4S — CID 87610265
N-benzyl-4-[(5-bromo-3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline bromide (PubChem CID 87610265) has the molecular formula C18H18Br2N4S and a molecular weight of 482.25 g/mol. Its IUPAC name is N-benzyl-4-[(5-bromo-3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline bromide.
| Compound Name | N-benzyl-4-[(5-bromo-3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline bromide |
|---|---|
| PubChem CID | 87610265 |
| Molecular Formula | C18H18Br2N4S |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | N-benzyl-4-[(5-bromo-3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline bromide |
| SMILES | CN(Cc1ccccc1)c1ccc(/N=N/c2sc(Br)c[n+]2C)cc1.[Br-] |
| InChI | InChI=1S/C18H18BrN4S.BrH/c1-22(12-14-6-4-3-5-7-14)16-10-8-15(9-11-16)20-21-18-23(2)13-17(19)24-18;/h3-11,13H,12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | AQUAWORXMHWENK-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|