C20H24N4O4S2 — CID 87610602
N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline;methyl sulfate (PubChem CID 87610602) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline;methyl sulfate.
| Compound Name | N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline;methyl sulfate |
|---|---|
| PubChem CID | 87610602 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-benzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cc1c[n+](C)c(/N=N/c2ccc(N(C)Cc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H21N4S.CH4O4S/c1-15-13-23(3)19(24-15)21-20-17-9-11-18(12-10-17)22(2)14-16-7-5-4-6-8-16;1-5-6(2,3)4/h4-13H,14H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BKOMNNWZSMVDGC-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|