C23H30N4O4S2 — CID 87611479
N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate (PubChem CID 87611479) has the molecular formula C23H30N4O4S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate.
| Compound Name | N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate |
|---|---|
| PubChem CID | 87611479 |
| Molecular Formula | C23H30N4O4S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/c2sc(C)c(C)[n+]2C)c(C)c1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H27N4S.CH4O4S/c1-6-26(15-19-10-8-7-9-11-19)20-12-13-21(16(2)14-20)23-24-22-25(5)17(3)18(4)27-22;1-5-6(2,3)4/h7-14H,6,15H2,1-5H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | KBWDQZDMHASCOR-UHFFFAOYSA-M |
| XLogP | 5.03 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|