C13H21N3O3S — CID 23382176
methyl 2-[N-ethyl-3-methyl-4-(methyldiazenyl)anilino]ethanesulfonate (PubChem CID 23382176) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is methyl 2-[N-ethyl-3-methyl-4-(methyldiazenyl)anilino]ethanesulfonate.
| Compound Name | methyl 2-[N-ethyl-3-methyl-4-(methyldiazenyl)anilino]ethanesulfonate |
|---|---|
| PubChem CID | 23382176 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 2-[N-ethyl-3-methyl-4-(methyldiazenyl)anilino]ethanesulfonate |
| SMILES | CCN(CCS(=O)(=O)OC)c1ccc(/N=N/C)c(C)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-5-16(8-9-20(17,18)19-4)12-6-7-13(15-14-3)11(2)10-12/h6-7,10H,5,8-9H2,1-4H3/b15-14+ |
| InChIKey | XIJRSPIYIJPKQZ-CCEZHUSRSA-N |
| XLogP | 2.51 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|