2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate

C11H17N3O3 — CID 131700851

IUPAC2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate
SMILESCCN(CCO[N+](=O)[O-])c1ccc(N)c(C)c1
InChIInChI=1S/C11H17N3O3/c1-3-13(6-7-17-14(15)16)10-4-5-11(12)9(2)8-10/h4-5,8H,3,6-7,12H2,1-2H3
InChIKeyDQRQDKWCKCOKBL-UHFFFAOYSA-N
MW239.27 g/mol
LogP1.61
Rot. Bonds6

About 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate

2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate (PubChem CID 131700851) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate.

Molecular Properties

Compound Name2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate
PubChem CID131700851
Molecular FormulaC11H17N3O3
Molecular Weight239.27 g/mol
Exact Mass239.13
IUPAC Name2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate
SMILESCCN(CCO[N+](=O)[O-])c1ccc(N)c(C)c1
InChIInChI=1S/C11H17N3O3/c1-3-13(6-7-17-14(15)16)10-4-5-11(12)9(2)8-10/h4-5,8H,3,6-7,12H2,1-2H3
InChIKeyDQRQDKWCKCOKBL-UHFFFAOYSA-N
XLogP1.61
TPSA81.63 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate?
The IUPAC name of 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate (CID 131700851) is 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate.
What is the SMILES notation for 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate?
The canonical SMILES for 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate is CCN(CCO[N+](=O)[O-])c1ccc(N)c(C)c1.
What is the InChIKey of 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate?
The InChIKey is DQRQDKWCKCOKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c1-3-13(6-7-17-14(15)16)10-4-5-11(12)9(2)8-10/h4-5,8H,3,6-7,12H2,1-2H3.
What are the key properties of 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate?
2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate has a molecular weight of 239.27 g/mol, XLogP of 1.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-N-ethyl-3-methylanilino)ethyl nitrate is sourced from PubChem (CID 131700851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).