C12H23N3O7S2-2 — CID 22486762
N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfate;hydrate (PubChem CID 22486762) has the molecular formula C12H23N3O7S2-2 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfate;hydrate.
| Compound Name | N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfate;hydrate |
|---|---|
| PubChem CID | 22486762 |
| Molecular Formula | C12H23N3O7S2-2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfate;hydrate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(N)c(C)c1.O.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C12H21N3O2S.H2O4S.H2O/c1-4-15(8-7-14-18(3,16)17)11-5-6-12(13)10(2)9-11;1-5(2,3)4;/h5-6,9,14H,4,7-8,13H2,1-3H3;(H2,1,2,3,4);1H2/p-2 |
| InChIKey | QRBFSNYYMHZRGU-UHFFFAOYSA-L |
| XLogP | -1.21 |
| TPSA | 187.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|