C14H29N3O7S2 — CID 67688856
N-[2-(4-amino-N,2-diethyl-3-methylanilino)ethyl]methanesulfonamide;sulfuric acid;hydrate (PubChem CID 67688856) has the molecular formula C14H29N3O7S2 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[2-(4-amino-N,2-diethyl-3-methylanilino)ethyl]methanesulfonamide;sulfuric acid;hydrate.
| Compound Name | N-[2-(4-amino-N,2-diethyl-3-methylanilino)ethyl]methanesulfonamide;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 67688856 |
| Molecular Formula | C14H29N3O7S2 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[2-(4-amino-N,2-diethyl-3-methylanilino)ethyl]methanesulfonamide;sulfuric acid;hydrate |
| SMILES | CCc1c(N(CC)CCNS(C)(=O)=O)ccc(N)c1C.O.O=S(=O)(O)O |
| InChI | InChI=1S/C14H25N3O2S.H2O4S.H2O/c1-5-12-11(3)13(15)7-8-14(12)17(6-2)10-9-16-20(4,18)19;1-5(2,3)4;/h7-8,16H,5-6,9-10,15H2,1-4H3;(H2,1,2,3,4);1H2 |
| InChIKey | YNSWLTVUKZRTNX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 181.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|