C12H22ClN3O2S — CID 23320322
N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;hydrochloride (PubChem CID 23320322) has the molecular formula C12H22ClN3O2S and a molecular weight of 307.85 g/mol. Its IUPAC name is N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 23320322 |
| Molecular Formula | C12H22ClN3O2S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[2-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;hydrochloride |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(N)c(C)c1.Cl |
| InChI | InChI=1S/C12H21N3O2S.ClH/c1-4-15(8-7-14-18(3,16)17)11-5-6-12(13)10(2)9-11;/h5-6,9,14H,4,7-8,13H2,1-3H3;1H |
| InChIKey | YTAGNDKLJREJEG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|