C21H27N3O5S — CID 22095187
(4-formylphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate (PubChem CID 22095187) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is (4-formylphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate.
| Compound Name | (4-formylphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22095187 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (4-formylphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(NC(=O)OCc2ccc(C=O)cc2)c(C)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-4-24(12-11-22-30(3,27)28)19-9-10-20(16(2)13-19)23-21(26)29-15-18-7-5-17(14-25)6-8-18/h5-10,13-14,22H,4,11-12,15H2,1-3H3,(H,23,26) |
| InChIKey | FSBYXBVNJOEFHY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|